C23H30N4O3S — CID 154913475
2-(benzimidazol-1-yl)-N-[[1-[(3-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]propanamide;formic acid (PubChem CID 154913475) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N-[[1-[(3-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]propanamide;formic acid.
| Compound Name | 2-(benzimidazol-1-yl)-N-[[1-[(3-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]propanamide;formic acid |
|---|---|
| PubChem CID | 154913475 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N-[[1-[(3-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]propanamide;formic acid |
| SMILES | Cc1ccsc1CN1CCC(CNC(=O)C(C)n2cnc3ccccc32)CC1.O=CO |
| InChI | InChI=1S/C22H28N4OS.CH2O2/c1-16-9-12-28-21(16)14-25-10-7-18(8-11-25)13-23-22(27)17(2)26-15-24-19-5-3-4-6-20(19)26;2-1-3/h3-6,9,12,15,17-18H,7-8,10-11,13-14H2,1-2H3,(H,23,27);1H,(H,2,3) |
| InChIKey | AGFFNKRSHYQIAO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|