C18H27N3O4 — CID 154913506
2,4-dimethyl-N-[(1-pent-2-ynylpiperidin-4-yl)methyl]-1,3-oxazole-5-carboxamide;formic acid (PubChem CID 154913506) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(1-pent-2-ynylpiperidin-4-yl)methyl]-1,3-oxazole-5-carboxamide;formic acid.
| Compound Name | 2,4-dimethyl-N-[(1-pent-2-ynylpiperidin-4-yl)methyl]-1,3-oxazole-5-carboxamide;formic acid |
|---|---|
| PubChem CID | 154913506 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2,4-dimethyl-N-[(1-pent-2-ynylpiperidin-4-yl)methyl]-1,3-oxazole-5-carboxamide;formic acid |
| SMILES | CCC#CCN1CCC(CNC(=O)c2oc(C)nc2C)CC1.O=CO |
| InChI | InChI=1S/C17H25N3O2.CH2O2/c1-4-5-6-9-20-10-7-15(8-11-20)12-18-17(21)16-13(2)19-14(3)22-16;2-1-3/h15H,4,7-12H2,1-3H3,(H,18,21);1H,(H,2,3) |
| InChIKey | ILAWWVFFTYFUTC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|