C14H23N5O4 — CID 154913591
3-[[[1-(cyclobutanecarbonyl)piperidin-4-yl]amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one;formic acid (PubChem CID 154913591) has the molecular formula C14H23N5O4 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[[[1-(cyclobutanecarbonyl)piperidin-4-yl]amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one;formic acid.
| Compound Name | 3-[[[1-(cyclobutanecarbonyl)piperidin-4-yl]amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one;formic acid |
|---|---|
| PubChem CID | 154913591 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-[[[1-(cyclobutanecarbonyl)piperidin-4-yl]amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one;formic acid |
| SMILES | O=C(C1CCC1)N1CCC(NCc2n[nH]c(=O)[nH]2)CC1.O=CO |
| InChI | InChI=1S/C13H21N5O2.CH2O2/c19-12(9-2-1-3-9)18-6-4-10(5-7-18)14-8-11-15-13(20)17-16-11;2-1-3/h9-10,14H,1-8H2,(H2,15,16,17,20);1H,(H,2,3) |
| InChIKey | BETYAHZCMAZUTJ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|