C25H31N3O4 — CID 154914291
(3-ethoxyphenyl)-[4-[2-(1H-indol-3-yl)ethyl]-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 154914291) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is (3-ethoxyphenyl)-[4-[2-(1H-indol-3-yl)ethyl]-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | (3-ethoxyphenyl)-[4-[2-(1H-indol-3-yl)ethyl]-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154914291 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (3-ethoxyphenyl)-[4-[2-(1H-indol-3-yl)ethyl]-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | CCOc1cccc(C(=O)N2CCCN(CCc3c[nH]c4ccccc34)CC2)c1.O=CO |
| InChI | InChI=1S/C24H29N3O2.CH2O2/c1-2-29-21-8-5-7-19(17-21)24(28)27-13-6-12-26(15-16-27)14-11-20-18-25-23-10-4-3-9-22(20)23;2-1-3/h3-5,7-10,17-18,25H,2,6,11-16H2,1H3;1H,(H,2,3) |
| InChIKey | NVXGAZSBPQWDJW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|