C26H34N2O5 — CID 154914347
2-[(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide;formic acid (PubChem CID 154914347) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide;formic acid.
| Compound Name | 2-[(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide;formic acid |
|---|---|
| PubChem CID | 154914347 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide;formic acid |
| SMILES | COc1ccccc1CNC(=O)CN1CC[C@@](O)(c2ccccc2)[C@H]2CCCC[C@H]21.O=CO |
| InChI | InChI=1S/C25H32N2O3.CH2O2/c1-30-23-14-8-5-9-19(23)17-26-24(28)18-27-16-15-25(29,20-10-3-2-4-11-20)21-12-6-7-13-22(21)27;2-1-3/h2-5,8-11,14,21-22,29H,6-7,12-13,15-18H2,1H3,(H,26,28);1H,(H,2,3)/t21-,22+,25+;/m0./s1 |
| InChIKey | RSTHAOLSNIXMLZ-SKASSBGPSA-N |
| XLogP | 3.16 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|