C13H25N3O4S — CID 154914359
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid (PubChem CID 154914359) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid.
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid |
|---|---|
| PubChem CID | 154914359 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid |
| SMILES | Cc1n[nH]c(C)c1CCCN(C)CCS(C)(=O)=O.O=CO |
| InChI | InChI=1S/C12H23N3O2S.CH2O2/c1-10-12(11(2)14-13-10)6-5-7-15(3)8-9-18(4,16)17;2-1-3/h5-9H2,1-4H3,(H,13,14);1H,(H,2,3) |
| InChIKey | IFCCQQRMNXNHCV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|