About 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid (PubChem CID 154914359) has the molecular formula C13H25N3O4S
and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid |
| PubChem CID | 154914359 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid |
| SMILES | Cc1n[nH]c(C)c1CCCN(C)CCS(C)(=O)=O.O=CO |
| InChI | InChI=1S/C12H23N3O2S.CH2O2/c1-10-12(11(2)14-13-10)6-5-7-15(3)8-9-18(4,16)17;2-1-3/h5-9H2,1-4H3,(H,13,14);1H,(H,2,3) |
| InChIKey | IFCCQQRMNXNHCV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid (CID 154914359) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid is Cc1n[nH]c(C)c1CCCN(C)CCS(C)(=O)=O.O=CO.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid?
The InChIKey is IFCCQQRMNXNHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2S.CH2O2/c1-10-12(11(2)14-13-10)6-5-7-15(3)8-9-18(4,16)17;2-1-3/h5-9H2,1-4H3,(H,13,14);1H,(H,2,3).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid?
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid has a molecular weight of 319.43 g/mol, XLogP of 0.64, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-N-(2-methylsulfonylethyl)propan-1-amine;formic acid is sourced from PubChem (CID 154914359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).