About 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid
5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid (PubChem CID 154914395) has the molecular formula C21H35N3O3
and a molecular weight of 377.53 g/mol. Its IUPAC name is 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid.
Molecular Properties
| Compound Name | 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid |
| PubChem CID | 154914395 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid |
| SMILES | CCC1=NOC(CN2CCN(C34CC5CC(CC(C5)C3)C4)CC2)C1.O=CO |
| InChI | InChI=1S/C20H33N3O.CH2O2/c1-2-18-10-19(24-21-18)14-22-3-5-23(6-4-22)20-11-15-7-16(12-20)9-17(8-15)13-20;2-1-3/h15-17,19H,2-14H2,1H3;1H,(H,2,3) |
| InChIKey | GGJSIEGCRSRVII-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid?
The IUPAC name of 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid (CID 154914395) is 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid.
What is the SMILES notation for 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid?
The canonical SMILES for 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid is CCC1=NOC(CN2CCN(C34CC5CC(CC(C5)C3)C4)CC2)C1.O=CO.
What is the InChIKey of 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid?
The InChIKey is GGJSIEGCRSRVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N3O.CH2O2/c1-2-18-10-19(24-21-18)14-22-3-5-23(6-4-22)20-11-15-7-16(12-20)9-17(8-15)13-20;2-1-3/h15-17,19H,2-14H2,1H3;1H,(H,2,3).
What are the key properties of 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid?
5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid has a molecular weight of 377.53 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(1-adamantyl)piperazin-1-yl]methyl]-3-ethyl-4,5-dihydro-1,2-oxazole;formic acid is sourced from PubChem (CID 154914395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).