About formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine
formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine (PubChem CID 154914640) has the molecular formula C18H34N4O4
and a molecular weight of 370.49 g/mol. Its IUPAC name is formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine.
Molecular Properties
| Compound Name | formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine |
| PubChem CID | 154914640 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine |
| SMILES | Cc1nc(CN(C)CCC(C)N2CCCC2)n(C)c1C.O=CO.O=CO |
| InChI | InChI=1S/C16H30N4.2CH2O2/c1-13(20-9-6-7-10-20)8-11-18(4)12-16-17-14(2)15(3)19(16)5;2*2-1-3/h13H,6-12H2,1-5H3;2*1H,(H,2,3) |
| InChIKey | ADMOUWRISPUQRT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine?
The IUPAC name of formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine (CID 154914640) is formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine.
What is the SMILES notation for formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine?
The canonical SMILES for formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine is Cc1nc(CN(C)CCC(C)N2CCCC2)n(C)c1C.O=CO.O=CO.
What is the InChIKey of formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine?
The InChIKey is ADMOUWRISPUQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4.2CH2O2/c1-13(20-9-6-7-10-20)8-11-18(4)12-16-17-14(2)15(3)19(16)5;2*2-1-3/h13H,6-12H2,1-5H3;2*1H,(H,2,3).
What are the key properties of formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine?
formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine has a molecular weight of 370.49 g/mol, XLogP of 1.74, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;N-methyl-3-pyrrolidin-1-yl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]butan-1-amine is sourced from PubChem (CID 154914640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).