C20H31ClN4O5 — CID 154914764
N-(3-chloro-4-methoxyphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid (PubChem CID 154914764) has the molecular formula C20H31ClN4O5 and a molecular weight of 442.94 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154914764 |
| Molecular Formula | C20H31ClN4O5 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid |
| SMILES | COc1ccc(NC(=O)N2CCC(N3CCN(CCO)CC3)CC2)cc1Cl.O=CO |
| InChI | InChI=1S/C19H29ClN4O3.CH2O2/c1-27-18-3-2-15(14-17(18)20)21-19(26)24-6-4-16(5-7-24)23-10-8-22(9-11-23)12-13-25;2-1-3/h2-3,14,16,25H,4-13H2,1H3,(H,21,26);1H,(H,2,3) |
| InChIKey | SQFYWUZKNYNWBB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|