C17H25N3O7S — CID 154915220
formic acid;N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 154915220) has the molecular formula C17H25N3O7S and a molecular weight of 415.47 g/mol. Its IUPAC name is formic acid;N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | formic acid;N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 154915220 |
| Molecular Formula | C17H25N3O7S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | formic acid;N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | COCCN1CCC(CN(C)S(=O)(=O)c2ccc3oc(=O)[nH]c3c2)C1.O=CO |
| InChI | InChI=1S/C16H23N3O5S.CH2O2/c1-18(10-12-5-6-19(11-12)7-8-23-2)25(21,22)13-3-4-15-14(9-13)17-16(20)24-15;2-1-3/h3-4,9,12H,5-8,10-11H2,1-2H3,(H,17,20);1H,(H,2,3) |
| InChIKey | PQXKWYUYTQPEDE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|