C20H33N3O4 — CID 154915543
(3aS,6aR)-2-N,2-N,5-N-trimethyl-5-N-[(5-methyl-2-pyridinyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid (PubChem CID 154915543) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is (3aS,6aR)-2-N,2-N,5-N-trimethyl-5-N-[(5-methyl-2-pyridinyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid.
| Compound Name | (3aS,6aR)-2-N,2-N,5-N-trimethyl-5-N-[(5-methyl-2-pyridinyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid |
|---|---|
| PubChem CID | 154915543 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (3aS,6aR)-2-N,2-N,5-N-trimethyl-5-N-[(5-methyl-2-pyridinyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid |
| SMILES | Cc1ccc(CN(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)nc1.O=CO.O=CO |
| InChI | InChI=1S/C18H29N3.2CH2O2/c1-13-5-6-16(19-11-13)12-21(4)18-9-14-7-17(20(2)3)8-15(14)10-18;2*2-1-3/h5-6,11,14-15,17-18H,7-10,12H2,1-4H3;2*1H,(H,2,3)/t14-,15+,17?,18?;; |
| InChIKey | UXQUKUBDHCGFES-DYWBRGKRSA-N |
| XLogP | 2.34 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|