C24H37N3O5 — CID 154915737
cyclopropyl-[4-[2-[4-[(dimethylamino)methyl]phenyl]pyrrolidin-1-yl]piperidin-1-yl]methanone;formic acid (PubChem CID 154915737) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is cyclopropyl-[4-[2-[4-[(dimethylamino)methyl]phenyl]pyrrolidin-1-yl]piperidin-1-yl]methanone;formic acid.
| Compound Name | cyclopropyl-[4-[2-[4-[(dimethylamino)methyl]phenyl]pyrrolidin-1-yl]piperidin-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154915737 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | cyclopropyl-[4-[2-[4-[(dimethylamino)methyl]phenyl]pyrrolidin-1-yl]piperidin-1-yl]methanone;formic acid |
| SMILES | CN(C)Cc1ccc(C2CCCN2C2CCN(C(=O)C3CC3)CC2)cc1.O=CO.O=CO |
| InChI | InChI=1S/C22H33N3O.2CH2O2/c1-23(2)16-17-5-7-18(8-6-17)21-4-3-13-25(21)20-11-14-24(15-12-20)22(26)19-9-10-19;2*2-1-3/h5-8,19-21H,3-4,9-16H2,1-2H3;2*1H,(H,2,3) |
| InChIKey | PCNGRKYCZUTGRI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|