C21H30N4O3S — CID 154915759
N-benzyl-2-(4-methyl-1,4-diazepan-1-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide;formic acid (PubChem CID 154915759) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-benzyl-2-(4-methyl-1,4-diazepan-1-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide;formic acid.
| Compound Name | N-benzyl-2-(4-methyl-1,4-diazepan-1-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide;formic acid |
|---|---|
| PubChem CID | 154915759 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-benzyl-2-(4-methyl-1,4-diazepan-1-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide;formic acid |
| SMILES | Cc1ncsc1CN(Cc1ccccc1)C(=O)CN1CCCN(C)CC1.O=CO |
| InChI | InChI=1S/C20H28N4OS.CH2O2/c1-17-19(26-16-21-17)14-24(13-18-7-4-3-5-8-18)20(25)15-23-10-6-9-22(2)11-12-23;2-1-3/h3-5,7-8,16H,6,9-15H2,1-2H3;1H,(H,2,3) |
| InChIKey | PWLLUUBGRHNPDZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|