C18H23F3N4O7 — CID 154916183
(1S,5R)-3-[2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 154916183) has the molecular formula C18H23F3N4O7 and a molecular weight of 464.40 g/mol. Its IUPAC name is (1S,5R)-3-[2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,5R)-3-[2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154916183 |
| Molecular Formula | C18H23F3N4O7 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (1S,5R)-3-[2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCn1nc(C)c(NC(=O)CN2C[C@@]3(C(=O)O)C[C@@]3(C(=O)O)C2)c1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N4O5.C2HF3O2/c1-4-20-10(3)12(9(2)18-20)17-11(21)5-19-7-15(13(22)23)6-16(15,8-19)14(24)25;3-2(4,5)1(6)7/h4-8H2,1-3H3,(H,17,21)(H,22,23)(H,24,25);(H,6,7)/t15-,16+; |
| InChIKey | CMRWBXYQBCMVNO-FAESNJTISA-N |
| XLogP | 0.95 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |