C20H22ClN3O4 — CID 154916429
5-[[(3R,4R)-1-(6-chloroquinolin-4-yl)-4-methoxypyrrolidin-3-yl]methyl]-3-methyl-1,2-oxazole;formic acid (PubChem CID 154916429) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is 5-[[(3R,4R)-1-(6-chloroquinolin-4-yl)-4-methoxypyrrolidin-3-yl]methyl]-3-methyl-1,2-oxazole;formic acid.
| Compound Name | 5-[[(3R,4R)-1-(6-chloroquinolin-4-yl)-4-methoxypyrrolidin-3-yl]methyl]-3-methyl-1,2-oxazole;formic acid |
|---|---|
| PubChem CID | 154916429 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 5-[[(3R,4R)-1-(6-chloroquinolin-4-yl)-4-methoxypyrrolidin-3-yl]methyl]-3-methyl-1,2-oxazole;formic acid |
| SMILES | CO[C@H]1CN(c2ccnc3ccc(Cl)cc23)C[C@H]1Cc1cc(C)no1.O=CO |
| InChI | InChI=1S/C19H20ClN3O2.CH2O2/c1-12-7-15(25-22-12)8-13-10-23(11-19(13)24-2)18-5-6-21-17-4-3-14(20)9-16(17)18;2-1-3/h3-7,9,13,19H,8,10-11H2,1-2H3;1H,(H,2,3)/t13-,19+;/m1./s1 |
| InChIKey | ZIMAMNHNZZTOGV-QVRIGTRMSA-N |
| XLogP | 3.58 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|