C14H20N2O5 — CID 154916899
formic acid;(1S,5R)-7-(furan-3-ylmethyl)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 154916899) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is formic acid;(1S,5R)-7-(furan-3-ylmethyl)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | formic acid;(1S,5R)-7-(furan-3-ylmethyl)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 154916899 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | formic acid;(1S,5R)-7-(furan-3-ylmethyl)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | CN1C(=O)[C@H]2COC[C@@H]1CN(Cc1ccoc1)C2.O=CO |
| InChI | InChI=1S/C13H18N2O3.CH2O2/c1-14-12-6-15(4-10-2-3-17-7-10)5-11(13(14)16)8-18-9-12;2-1-3/h2-3,7,11-12H,4-6,8-9H2,1H3;1H,(H,2,3)/t11-,12+;/m1./s1 |
| InChIKey | ULWANAVBWXUIQT-LYCTWNKOSA-N |
| XLogP | 0.27 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|