C22H34N4O5 — CID 154916924
formic acid;1-[4-[1-(2-methoxyethyl)piperidine-3-carbonyl]-1,4-diazepan-1-yl]-2-pyridin-4-ylethanone (PubChem CID 154916924) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is formic acid;1-[4-[1-(2-methoxyethyl)piperidine-3-carbonyl]-1,4-diazepan-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | formic acid;1-[4-[1-(2-methoxyethyl)piperidine-3-carbonyl]-1,4-diazepan-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 154916924 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | formic acid;1-[4-[1-(2-methoxyethyl)piperidine-3-carbonyl]-1,4-diazepan-1-yl]-2-pyridin-4-ylethanone |
| SMILES | COCCN1CCCC(C(=O)N2CCCN(C(=O)Cc3ccncc3)CC2)C1.O=CO |
| InChI | InChI=1S/C21H32N4O3.CH2O2/c1-28-15-14-23-9-2-4-19(17-23)21(27)25-11-3-10-24(12-13-25)20(26)16-18-5-7-22-8-6-18;2-1-3/h5-8,19H,2-4,9-17H2,1H3;1H,(H,2,3) |
| InChIKey | YRUFNZFMYWZASZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|