C22H30Cl2N4O3 — CID 154917186
2-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-(4-methoxyphenyl)pyridine-3-carboxylic acid;dihydrochloride (PubChem CID 154917186) has the molecular formula C22H30Cl2N4O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is 2-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-(4-methoxyphenyl)pyridine-3-carboxylic acid;dihydrochloride.
| Compound Name | 2-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-(4-methoxyphenyl)pyridine-3-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 154917186 |
| Molecular Formula | C22H30Cl2N4O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-(4-methoxyphenyl)pyridine-3-carboxylic acid;dihydrochloride |
| SMILES | COc1ccc(-c2ccc(C(=O)O)c(N3CC4CNCC4(CN(C)C)C3)n2)cc1.Cl.Cl |
| InChI | InChI=1S/C22H28N4O3.2ClH/c1-25(2)13-22-12-23-10-16(22)11-26(14-22)20-18(21(27)28)8-9-19(24-20)15-4-6-17(29-3)7-5-15;;/h4-9,16,23H,10-14H2,1-3H3,(H,27,28);2*1H |
| InChIKey | XZPJSUNYMBDQAQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |