About (4-aminophenyl) 4-aminobenzoate
(4-aminophenyl) 4-aminobenzoate (PubChem CID 15491725) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is (4-aminophenyl) 4-aminobenzoate.
Molecular Properties
| Compound Name | (4-aminophenyl) 4-aminobenzoate |
| PubChem CID | 15491725 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (4-aminophenyl) 4-aminobenzoate |
| SMILES | Nc1ccc(OC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H12N2O2/c14-10-3-1-9(2-4-10)13(16)17-12-7-5-11(15)6-8-12/h1-8H,14-15H2 |
| InChIKey | LOCTYHIHNCOYJZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) 4-aminobenzoate?
The IUPAC name of (4-aminophenyl) 4-aminobenzoate (CID 15491725) is (4-aminophenyl) 4-aminobenzoate.
What is the SMILES notation for (4-aminophenyl) 4-aminobenzoate?
The canonical SMILES for (4-aminophenyl) 4-aminobenzoate is Nc1ccc(OC(=O)c2ccc(N)cc2)cc1.
What is the InChIKey of (4-aminophenyl) 4-aminobenzoate?
The InChIKey is LOCTYHIHNCOYJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c14-10-3-1-9(2-4-10)13(16)17-12-7-5-11(15)6-8-12/h1-8H,14-15H2.
What are the key properties of (4-aminophenyl) 4-aminobenzoate?
(4-aminophenyl) 4-aminobenzoate has a molecular weight of 228.25 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) 4-aminobenzoate is sourced from PubChem (CID 15491725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).