C13H23ClN2O3 — CID 154917437
[3a-(hydroxymethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(methoxymethyl)cyclopropyl]methanone;hydrochloride (PubChem CID 154917437) has the molecular formula C13H23ClN2O3 and a molecular weight of 290.79 g/mol. Its IUPAC name is [3a-(hydroxymethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(methoxymethyl)cyclopropyl]methanone;hydrochloride.
| Compound Name | [3a-(hydroxymethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(methoxymethyl)cyclopropyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154917437 |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [3a-(hydroxymethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(methoxymethyl)cyclopropyl]methanone;hydrochloride |
| SMILES | COCC1(C(=O)N2CC3CNCC3(CO)C2)CC1.Cl |
| InChI | InChI=1S/C13H22N2O3.ClH/c1-18-9-12(2-3-12)11(17)15-5-10-4-14-6-13(10,7-15)8-16;/h10,14,16H,2-9H2,1H3;1H |
| InChIKey | PIGAMCFTGFMYRP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |