About (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid
(4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid (PubChem CID 154917831) has the molecular formula C15H23ClN4O3
and a molecular weight of 342.83 g/mol. Its IUPAC name is (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid.
Molecular Properties
| Compound Name | (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid |
| PubChem CID | 154917831 |
| Molecular Formula | C15H23ClN4O3 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid |
| SMILES | Cc1nc(N)nc(N2CCC[C@]3(CCC[C@H]3O)C2)c1Cl.O=CO |
| InChI | InChI=1S/C14H21ClN4O.CH2O2/c1-9-11(15)12(18-13(16)17-9)19-7-3-6-14(8-19)5-2-4-10(14)20;2-1-3/h10,20H,2-8H2,1H3,(H2,16,17,18);1H,(H,2,3)/t10-,14-;/m1./s1 |
| InChIKey | ZJZXWDQEELMUEI-BWTUWSSMSA-N |
| XLogP | 1.85 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid?
The IUPAC name of (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid (CID 154917831) is (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid.
What is the SMILES notation for (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid?
The canonical SMILES for (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid is Cc1nc(N)nc(N2CCC[C@]3(CCC[C@H]3O)C2)c1Cl.O=CO.
What is the InChIKey of (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid?
The InChIKey is ZJZXWDQEELMUEI-BWTUWSSMSA-N. The full InChI is InChI=1S/C14H21ClN4O.CH2O2/c1-9-11(15)12(18-13(16)17-9)19-7-3-6-14(8-19)5-2-4-10(14)20;2-1-3/h10,20H,2-8H2,1H3,(H2,16,17,18);1H,(H,2,3)/t10-,14-;/m1./s1.
What are the key properties of (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid?
(4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid has a molecular weight of 342.83 g/mol, XLogP of 1.85, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-7-(2-amino-5-chloro-6-methylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol;formic acid is sourced from PubChem (CID 154917831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).