About 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride
5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride (PubChem CID 154917980) has the molecular formula C16H25ClN4O3
and a molecular weight of 356.85 g/mol. Its IUPAC name is 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride |
| PubChem CID | 154917980 |
| Molecular Formula | C16H25ClN4O3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride |
| SMILES | COc1cccc(OCCN(C)c2nnc(CCCCN)o2)c1.Cl |
| InChI | InChI=1S/C16H24N4O3.ClH/c1-20(16-19-18-15(23-16)8-3-4-9-17)10-11-22-14-7-5-6-13(12-14)21-2;/h5-7,12H,3-4,8-11,17H2,1-2H3;1H |
| InChIKey | HSSTYYYQCZXRTN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride?
The IUPAC name of 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride (CID 154917980) is 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride?
The canonical SMILES for 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride is COc1cccc(OCCN(C)c2nnc(CCCCN)o2)c1.Cl.
What is the InChIKey of 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride?
The InChIKey is HSSTYYYQCZXRTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O3.ClH/c1-20(16-19-18-15(23-16)8-3-4-9-17)10-11-22-14-7-5-6-13(12-14)21-2;/h5-7,12H,3-4,8-11,17H2,1-2H3;1H.
What are the key properties of 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride?
5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride has a molecular weight of 356.85 g/mol, XLogP of 2.30, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-aminobutyl)-N-[2-(3-methoxyphenoxy)ethyl]-N-methyl-1,3,4-oxadiazol-2-amine;hydrochloride is sourced from PubChem (CID 154917980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).