About 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene
7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene (PubChem CID 15491825) has the molecular formula C14H10
and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene |
| PubChem CID | 15491825 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene |
| SMILES | C(=C=C1C=CC=C1)=C1C=CC=CC=C1 |
| InChI | InChI=1S/C14H10/c1-2-4-8-13(7-3-1)11-12-14-9-5-6-10-14/h1-10H |
| InChIKey | YVEFVGSWEBDTFZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene?
The IUPAC name of 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene (CID 15491825) is 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene.
What is the SMILES notation for 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene?
The canonical SMILES for 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene is C(=C=C1C=CC=C1)=C1C=CC=CC=C1.
What is the InChIKey of 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene?
The InChIKey is YVEFVGSWEBDTFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10/c1-2-4-8-13(7-3-1)11-12-14-9-5-6-10-14/h1-10H.
What are the key properties of 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene?
7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene has a molecular weight of 178.23 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-cyclopenta-2,4-dien-1-ylideneethenylidene)cyclohepta-1,3,5-triene is sourced from PubChem (CID 15491825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).