C22H28Cl3N3O2 — CID 154918358
2-(4-aminophenyl)-1-[(1S,5R)-9-[(4-chlorophenyl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;dihydrochloride (PubChem CID 154918358) has the molecular formula C22H28Cl3N3O2 and a molecular weight of 472.84 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[(1S,5R)-9-[(4-chlorophenyl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[(1S,5R)-9-[(4-chlorophenyl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 154918358 |
| Molecular Formula | C22H28Cl3N3O2 |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 2-(4-aminophenyl)-1-[(1S,5R)-9-[(4-chlorophenyl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)N2C[C@@H]3COC[C@H](C2)N(Cc2ccc(Cl)cc2)C3)cc1 |
| InChI | InChI=1S/C22H26ClN3O2.2ClH/c23-19-5-1-17(2-6-19)10-25-11-18-12-26(13-21(25)15-28-14-18)22(27)9-16-3-7-20(24)8-4-16;;/h1-8,18,21H,9-15,24H2;2*1H/t18-,21+;;/m1../s1 |
| InChIKey | JSGWSZDNUXAODG-UITHODHBSA-N |
| XLogP | 3.67 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|