C18H19F4N3O3 — CID 154918593
(3S,4R)-1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol;formic acid (PubChem CID 154918593) has the molecular formula C18H19F4N3O3 and a molecular weight of 401.36 g/mol. Its IUPAC name is (3S,4R)-1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol;formic acid.
| Compound Name | (3S,4R)-1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol;formic acid |
|---|---|
| PubChem CID | 154918593 |
| Molecular Formula | C18H19F4N3O3 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (3S,4R)-1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-(pyrazin-2-ylmethyl)pyrrolidin-3-ol;formic acid |
| SMILES | O=CO.O[C@@H]1CN(Cc2cc(F)cc(C(F)(F)F)c2)C[C@H]1Cc1cnccn1 |
| InChI | InChI=1S/C17H17F4N3O.CH2O2/c18-14-4-11(3-13(6-14)17(19,20)21)8-24-9-12(16(25)10-24)5-15-7-22-1-2-23-15;2-1-3/h1-4,6-7,12,16,25H,5,8-10H2;1H,(H,2,3)/t12-,16-;/m1./s1 |
| InChIKey | LCFJFDMXXKBGPJ-VQZRABBESA-N |
| XLogP | 2.37 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|