C20H30N2O4S — CID 154918890
formic acid;(2R)-2-methoxy-2-phenyl-1-[4-(thian-4-yl)-1,4-diazepan-1-yl]ethanone (PubChem CID 154918890) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is formic acid;(2R)-2-methoxy-2-phenyl-1-[4-(thian-4-yl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | formic acid;(2R)-2-methoxy-2-phenyl-1-[4-(thian-4-yl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 154918890 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | formic acid;(2R)-2-methoxy-2-phenyl-1-[4-(thian-4-yl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CO[C@@H](C(=O)N1CCCN(C2CCSCC2)CC1)c1ccccc1.O=CO |
| InChI | InChI=1S/C19H28N2O2S.CH2O2/c1-23-18(16-6-3-2-4-7-16)19(22)21-11-5-10-20(12-13-21)17-8-14-24-15-9-17;2-1-3/h2-4,6-7,17-18H,5,8-15H2,1H3;1H,(H,2,3)/t18-;/m1./s1 |
| InChIKey | DZTMPSWLHXFYRB-GMUIIQOCSA-N |
| XLogP | 2.50 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|