C17H30N4O4 — CID 154918895
formic acid;2-methyl-5-propyl-N-(2-pyrrolidin-1-ylpropyl)pyrimidin-4-amine (PubChem CID 154918895) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is formic acid;2-methyl-5-propyl-N-(2-pyrrolidin-1-ylpropyl)pyrimidin-4-amine.
| Compound Name | formic acid;2-methyl-5-propyl-N-(2-pyrrolidin-1-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 154918895 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | formic acid;2-methyl-5-propyl-N-(2-pyrrolidin-1-ylpropyl)pyrimidin-4-amine |
| SMILES | CCCc1cnc(C)nc1NCC(C)N1CCCC1.O=CO.O=CO |
| InChI | InChI=1S/C15H26N4.2CH2O2/c1-4-7-14-11-16-13(3)18-15(14)17-10-12(2)19-8-5-6-9-19;2*2-1-3/h11-12H,4-10H2,1-3H3,(H,16,17,18);2*1H,(H,2,3) |
| InChIKey | UTLQQCTWTLFQID-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|