C16H31FN2O5 — CID 154918982
acetic acid;[5-(5-fluoropentyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154918982) has the molecular formula C16H31FN2O5 and a molecular weight of 350.43 g/mol. Its IUPAC name is acetic acid;[5-(5-fluoropentyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | acetic acid;[5-(5-fluoropentyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154918982 |
| Molecular Formula | C16H31FN2O5 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | acetic acid;[5-(5-fluoropentyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | CC(=O)O.CC(=O)O.OCC12CNCC1CN(CCCCCF)C2 |
| InChI | InChI=1S/C12H23FN2O.2C2H4O2/c13-4-2-1-3-5-15-7-11-6-14-8-12(11,9-15)10-16;2*1-2(3)4/h11,14,16H,1-10H2;2*1H3,(H,3,4) |
| InChIKey | HISLORJBNWEIOA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|