C19H24N4O5 — CID 154918994
formic acid;2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-N-pyridin-2-ylpropanamide (PubChem CID 154918994) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is formic acid;2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-N-pyridin-2-ylpropanamide.
| Compound Name | formic acid;2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 154918994 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | formic acid;2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-N-pyridin-2-ylpropanamide |
| SMILES | CC(C(=O)Nc1ccccn1)N1CCCN(C(=O)c2ccoc2)CC1.O=CO |
| InChI | InChI=1S/C18H22N4O3.CH2O2/c1-14(17(23)20-16-5-2-3-7-19-16)21-8-4-9-22(11-10-21)18(24)15-6-12-25-13-15;2-1-3/h2-3,5-7,12-14H,4,8-11H2,1H3,(H,19,20,23);1H,(H,2,3) |
| InChIKey | FVIVTMMNOGKCQI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|