C16H23N3O4 — CID 154919240
formic acid;(9-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-pyridin-4-ylmethanone (PubChem CID 154919240) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is formic acid;(9-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-pyridin-4-ylmethanone.
| Compound Name | formic acid;(9-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 154919240 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | formic acid;(9-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-pyridin-4-ylmethanone |
| SMILES | CN1CCC2(CC1)CN(C(=O)c1ccncc1)CCO2.O=CO |
| InChI | InChI=1S/C15H21N3O2.CH2O2/c1-17-8-4-15(5-9-17)12-18(10-11-20-15)14(19)13-2-6-16-7-3-13;2-1-3/h2-3,6-7H,4-5,8-12H2,1H3;1H,(H,2,3) |
| InChIKey | YJALLIJWHKUGMN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|