C16H20N4O4S — CID 154919272
formic acid;(4-methoxy-2-pyridinyl)-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 154919272) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is formic acid;(4-methoxy-2-pyridinyl)-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | formic acid;(4-methoxy-2-pyridinyl)-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 154919272 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | formic acid;(4-methoxy-2-pyridinyl)-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | COc1ccnc(C(=O)N2CCCN(c3nccs3)CC2)c1.O=CO |
| InChI | InChI=1S/C15H18N4O2S.CH2O2/c1-21-12-3-4-16-13(11-12)14(20)18-6-2-7-19(9-8-18)15-17-5-10-22-15;2-1-3/h3-5,10-11H,2,6-9H2,1H3;1H,(H,2,3) |
| InChIKey | RVHJVLZIOSQDPK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|