C16H28N2O5 — CID 154919324
acetic acid;(5-pent-4-ynyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl)methanol (PubChem CID 154919324) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is acetic acid;(5-pent-4-ynyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl)methanol.
| Compound Name | acetic acid;(5-pent-4-ynyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl)methanol |
|---|---|
| PubChem CID | 154919324 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | acetic acid;(5-pent-4-ynyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl)methanol |
| SMILES | C#CCCCN1CC2CNCC2(CO)C1.CC(=O)O.CC(=O)O |
| InChI | InChI=1S/C12H20N2O.2C2H4O2/c1-2-3-4-5-14-7-11-6-13-8-12(11,9-14)10-15;2*1-2(3)4/h1,11,13,15H,3-10H2;2*1H3,(H,3,4) |
| InChIKey | REPYVLYFAMZRPW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|