C13H19Cl3N2O — CID 154919733
(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride (PubChem CID 154919733) has the molecular formula C13H19Cl3N2O and a molecular weight of 325.67 g/mol. Its IUPAC name is (3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride.
| Compound Name | (3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride |
|---|---|
| PubChem CID | 154919733 |
| Molecular Formula | C13H19Cl3N2O |
| Molecular Weight | 325.67 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1C[C@H]2CO[C@@H](c3ccc(Cl)cc3)CN2C1 |
| InChI | InChI=1S/C13H17ClN2O.2ClH/c14-10-3-1-9(2-4-10)13-7-16-6-11(15)5-12(16)8-17-13;;/h1-4,11-13H,5-8,15H2;2*1H/t11-,12+,13-;;/m1../s1 |
| InChIKey | LZIRGZBIGZAGGM-IODZREEDSA-N |
| XLogP | 2.66 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |