C21H33N3O5 — CID 154919774
formic acid;N-[2-(2-methoxyphenyl)ethyl]-2-(1-methyl-9-oxa-1,4-diazaspiro[5.5]undecan-4-yl)acetamide (PubChem CID 154919774) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is formic acid;N-[2-(2-methoxyphenyl)ethyl]-2-(1-methyl-9-oxa-1,4-diazaspiro[5.5]undecan-4-yl)acetamide.
| Compound Name | formic acid;N-[2-(2-methoxyphenyl)ethyl]-2-(1-methyl-9-oxa-1,4-diazaspiro[5.5]undecan-4-yl)acetamide |
|---|---|
| PubChem CID | 154919774 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | formic acid;N-[2-(2-methoxyphenyl)ethyl]-2-(1-methyl-9-oxa-1,4-diazaspiro[5.5]undecan-4-yl)acetamide |
| SMILES | COc1ccccc1CCNC(=O)CN1CCN(C)C2(CCOCC2)C1.O=CO |
| InChI | InChI=1S/C20H31N3O3.CH2O2/c1-22-11-12-23(16-20(22)8-13-26-14-9-20)15-19(24)21-10-7-17-5-3-4-6-18(17)25-2;2-1-3/h3-6H,7-16H2,1-2H3,(H,21,24);1H,(H,2,3) |
| InChIKey | CRZIDIRPRHTCNZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|