About dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride
dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride (PubChem CID 15492) has the molecular formula C14H25ClN2O
and a molecular weight of 272.82 g/mol. Its IUPAC name is dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride.
Molecular Properties
| Compound Name | dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride |
| PubChem CID | 15492 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride |
| SMILES | CC1=CC(C)C(=O)N(CCC[NH+](C)C)C(C)=C1.[Cl-] |
| InChI | InChI=1S/C14H24N2O.ClH/c1-11-9-12(2)14(17)16(13(3)10-11)8-6-7-15(4)5;/h9-10,12H,6-8H2,1-5H3;1H |
| InChIKey | SCJRVCGEYWPLAA-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride?
The IUPAC name of dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride (CID 15492) is dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride.
What is the SMILES notation for dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride?
The canonical SMILES for dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride is CC1=CC(C)C(=O)N(CCC[NH+](C)C)C(C)=C1.[Cl-].
What is the InChIKey of dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride?
The InChIKey is SCJRVCGEYWPLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O.ClH/c1-11-9-12(2)14(17)16(13(3)10-11)8-6-7-15(4)5;/h9-10,12H,6-8H2,1-5H3;1H.
What are the key properties of dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride?
dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride has a molecular weight of 272.82 g/mol, XLogP of -2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[3-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)propyl]azanium chloride is sourced from PubChem (CID 15492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).