C21H29N3O3S — CID 154920153
(3,4-dimethylphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 154920153) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | (3,4-dimethylphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154920153 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (3,4-dimethylphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | CCc1nc(CN2CCCN(C(=O)c3ccc(C)c(C)c3)CC2)cs1.O=CO |
| InChI | InChI=1S/C20H27N3OS.CH2O2/c1-4-19-21-18(14-25-19)13-22-8-5-9-23(11-10-22)20(24)17-7-6-15(2)16(3)12-17;2-1-3/h6-7,12,14H,4-5,8-11,13H2,1-3H3;1H,(H,2,3) |
| InChIKey | FKRUZPBQCQYULU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|