C17H29N3O5S2 — CID 154920261
N,N-dimethyl-3-[4-(3-methylthiophene-2-carbonyl)-1,4-diazepan-1-yl]propane-1-sulfonamide;formic acid (PubChem CID 154920261) has the molecular formula C17H29N3O5S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-(3-methylthiophene-2-carbonyl)-1,4-diazepan-1-yl]propane-1-sulfonamide;formic acid.
| Compound Name | N,N-dimethyl-3-[4-(3-methylthiophene-2-carbonyl)-1,4-diazepan-1-yl]propane-1-sulfonamide;formic acid |
|---|---|
| PubChem CID | 154920261 |
| Molecular Formula | C17H29N3O5S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N,N-dimethyl-3-[4-(3-methylthiophene-2-carbonyl)-1,4-diazepan-1-yl]propane-1-sulfonamide;formic acid |
| SMILES | Cc1ccsc1C(=O)N1CCCN(CCCS(=O)(=O)N(C)C)CC1.O=CO |
| InChI | InChI=1S/C16H27N3O3S2.CH2O2/c1-14-6-12-23-15(14)16(20)19-9-4-7-18(10-11-19)8-5-13-24(21,22)17(2)3;2-1-3/h6,12H,4-5,7-11,13H2,1-3H3;1H,(H,2,3) |
| InChIKey | OVBVZKUXOCQSMW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|