C18H31N3O4S — CID 154920365
formic acid;1-[4-[4-(thiolan-3-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 154920365) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is formic acid;1-[4-[4-(thiolan-3-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | formic acid;1-[4-[4-(thiolan-3-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154920365 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | formic acid;1-[4-[4-(thiolan-3-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CCCN(C3CCSC3)CC2)CC1.O=CO |
| InChI | InChI=1S/C17H29N3O2S.CH2O2/c1-14(21)18-8-3-15(4-9-18)17(22)20-7-2-6-19(10-11-20)16-5-12-23-13-16;2-1-3/h15-16H,2-13H2,1H3;1H,(H,2,3) |
| InChIKey | FECANWBJFFXAJJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|