C18H26Cl2N4O2 — CID 154920576
methyl 2-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-1-methylbenzimidazole-5-carboxylate;dihydrochloride (PubChem CID 154920576) has the molecular formula C18H26Cl2N4O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is methyl 2-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-1-methylbenzimidazole-5-carboxylate;dihydrochloride.
| Compound Name | methyl 2-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-1-methylbenzimidazole-5-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 154920576 |
| Molecular Formula | C18H26Cl2N4O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methyl 2-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-1-methylbenzimidazole-5-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1ccc2c(c1)nc(N1CC[C@@H]3NCCC[C@@H]3C1)n2C.Cl.Cl |
| InChI | InChI=1S/C18H24N4O2.2ClH/c1-21-16-6-5-12(17(23)24-2)10-15(16)20-18(21)22-9-7-14-13(11-22)4-3-8-19-14;;/h5-6,10,13-14,19H,3-4,7-9,11H2,1-2H3;2*1H/t13-,14+;;/m1../s1 |
| InChIKey | APLDMMCOQWMSCN-BQFBZIMZSA-N |
| XLogP | 2.78 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |