C17H25ClN2O3 — CID 154920719
1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3-methoxyphenoxy)ethanone;hydrochloride (PubChem CID 154920719) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3-methoxyphenoxy)ethanone;hydrochloride.
| Compound Name | 1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3-methoxyphenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 154920719 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3-methoxyphenoxy)ethanone;hydrochloride |
| SMILES | COc1cccc(OCC(=O)N2CC[C@@H]3NCCC[C@@H]3C2)c1.Cl |
| InChI | InChI=1S/C17H24N2O3.ClH/c1-21-14-5-2-6-15(10-14)22-12-17(20)19-9-7-16-13(11-19)4-3-8-18-16;/h2,5-6,10,13,16,18H,3-4,7-9,11-12H2,1H3;1H/t13-,16+;/m1./s1 |
| InChIKey | FBSLGIQEOVZVLB-CACIRBSMSA-N |
| XLogP | 2.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |