C15H24N4O5 — CID 154921019
2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxylic acid;formic acid (PubChem CID 154921019) has the molecular formula C15H24N4O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxylic acid;formic acid.
| Compound Name | 2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 154921019 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxylic acid;formic acid |
| SMILES | CCn1ncnc1CN1CC(C(=O)O)C2(CCOCC2)C1.O=CO |
| InChI | InChI=1S/C14H22N4O3.CH2O2/c1-2-18-12(15-10-16-18)8-17-7-11(13(19)20)14(9-17)3-5-21-6-4-14;2-1-3/h10-11H,2-9H2,1H3,(H,19,20);1H,(H,2,3) |
| InChIKey | LUMPEZKHKLKTOK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|