C15H23N3O5S2 — CID 154921194
[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone;formic acid (PubChem CID 154921194) has the molecular formula C15H23N3O5S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone;formic acid.
| Compound Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone;formic acid |
|---|---|
| PubChem CID | 154921194 |
| Molecular Formula | C15H23N3O5S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone;formic acid |
| SMILES | Cc1nc(C)c(C(=O)N2C[C@H]3[C@H](N(C)C)CS(=O)(=O)[C@H]3C2)s1.O=CO |
| InChI | InChI=1S/C14H21N3O3S2.CH2O2/c1-8-13(21-9(2)15-8)14(18)17-5-10-11(16(3)4)7-22(19,20)12(10)6-17;2-1-3/h10-12H,5-7H2,1-4H3;1H,(H,2,3)/t10-,11+,12-;/m0./s1 |
| InChIKey | FYVOBCOILRVOTI-XNGOQOFYSA-N |
| XLogP | 0.26 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|