C9H13ClN4O2 — CID 154921401
N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 154921401) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154921401 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cc1nonc1CNC(=O)C1C=CCN1.Cl |
| InChI | InChI=1S/C9H12N4O2.ClH/c1-6-8(13-15-12-6)5-11-9(14)7-3-2-4-10-7;/h2-3,7,10H,4-5H2,1H3,(H,11,14);1H |
| InChIKey | RKGHHAHTAHBAPL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|