C33H43N7O7S — CID 154921804
(4S,17S)-4-benzyl-13-(1-ethylpiperidine-4-carbonyl)-17-propan-2-yl-6-oxa-19-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione;formic acid (PubChem CID 154921804) has the molecular formula C33H43N7O7S and a molecular weight of 681.82 g/mol. Its IUPAC name is (4S,17S)-4-benzyl-13-(1-ethylpiperidine-4-carbonyl)-17-propan-2-yl-6-oxa-19-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione;formic acid.
| Compound Name | (4S,17S)-4-benzyl-13-(1-ethylpiperidine-4-carbonyl)-17-propan-2-yl-6-oxa-19-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione;formic acid |
|---|---|
| PubChem CID | 154921804 |
| Molecular Formula | C33H43N7O7S |
| Molecular Weight | 681.82 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | (4S,17S)-4-benzyl-13-(1-ethylpiperidine-4-carbonyl)-17-propan-2-yl-6-oxa-19-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione;formic acid |
| SMILES | CCN1CCC(C(=O)N2CCNC(=O)c3coc(n3)[C@H](Cc3ccccc3)NC(=O)c3csc(n3)[C@H](C(C)C)NC(=O)C2)CC1.O=CO |
| InChI | InChI=1S/C32H41N7O5S.CH2O2/c1-4-38-13-10-22(11-14-38)32(43)39-15-12-33-28(41)24-18-44-30(35-24)23(16-21-8-6-5-7-9-21)34-29(42)25-19-45-31(36-25)27(20(2)3)37-26(40)17-39;2-1-3/h5-9,18-20,22-23,27H,4,10-17H2,1-3H3,(H,33,41)(H,34,42)(H,37,40);1H,(H,2,3)/t23-,27-;/m0./s1 |
| InChIKey | IYKXDAHASFREIL-QAVRJCAVSA-N |
| XLogP | 2.66 |
| TPSA | 187.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.82 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|