C15H25N5O3 — CID 154921863
(1S,5R,6R)-3-[2-amino-6-(diethylamino)pyrimidin-4-yl]-3-azabicyclo[3.2.0]heptan-6-ol;formic acid (PubChem CID 154921863) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is (1S,5R,6R)-3-[2-amino-6-(diethylamino)pyrimidin-4-yl]-3-azabicyclo[3.2.0]heptan-6-ol;formic acid.
| Compound Name | (1S,5R,6R)-3-[2-amino-6-(diethylamino)pyrimidin-4-yl]-3-azabicyclo[3.2.0]heptan-6-ol;formic acid |
|---|---|
| PubChem CID | 154921863 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (1S,5R,6R)-3-[2-amino-6-(diethylamino)pyrimidin-4-yl]-3-azabicyclo[3.2.0]heptan-6-ol;formic acid |
| SMILES | CCN(CC)c1cc(N2C[C@H]3C[C@@H](O)[C@H]3C2)nc(N)n1.O=CO |
| InChI | InChI=1S/C14H23N5O.CH2O2/c1-3-18(4-2)12-6-13(17-14(15)16-12)19-7-9-5-11(20)10(9)8-19;2-1-3/h6,9-11,20H,3-5,7-8H2,1-2H3,(H2,15,16,17);1H,(H,2,3)/t9-,10+,11-;/m1./s1 |
| InChIKey | MYRIBMYKZXHODO-QJQMQQLTSA-N |
| XLogP | 0.42 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|