About 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid
4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid (PubChem CID 154922181) has the molecular formula C17H27N5O2
and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid.
Molecular Properties
| Compound Name | 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid |
| PubChem CID | 154922181 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid |
| SMILES | Cc1nn(C)cc1-n1ccnc1C1CCN(C(C)C)CC1.O=CO |
| InChI | InChI=1S/C16H25N5.CH2O2/c1-12(2)20-8-5-14(6-9-20)16-17-7-10-21(16)15-11-19(4)18-13(15)3;2-1-3/h7,10-12,14H,5-6,8-9H2,1-4H3;1H,(H,2,3) |
| InChIKey | JDSQGOUTGBZNAH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid?
The IUPAC name of 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid (CID 154922181) is 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid.
What is the SMILES notation for 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid?
The canonical SMILES for 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid is Cc1nn(C)cc1-n1ccnc1C1CCN(C(C)C)CC1.O=CO.
What is the InChIKey of 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid?
The InChIKey is JDSQGOUTGBZNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N5.CH2O2/c1-12(2)20-8-5-14(6-9-20)16-17-7-10-21(16)15-11-19(4)18-13(15)3;2-1-3/h7,10-12,14H,5-6,8-9H2,1-4H3;1H,(H,2,3).
What are the key properties of 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid?
4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid has a molecular weight of 333.44 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,3-dimethylpyrazol-4-yl)imidazol-2-yl]-1-propan-2-ylpiperidine;formic acid is sourced from PubChem (CID 154922181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).