C20H23N3O5 — CID 154923354
(1R,2R,4S)-2-benzyl-7-(3-methylimidazole-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid (PubChem CID 154923354) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (1R,2R,4S)-2-benzyl-7-(3-methylimidazole-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid.
| Compound Name | (1R,2R,4S)-2-benzyl-7-(3-methylimidazole-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 154923354 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (1R,2R,4S)-2-benzyl-7-(3-methylimidazole-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid |
| SMILES | Cn1cncc1C(=O)N1[C@H]2CC[C@@H]1[C@](Cc1ccccc1)(C(=O)O)C2.O=CO |
| InChI | InChI=1S/C19H21N3O3.CH2O2/c1-21-12-20-11-15(21)17(23)22-14-7-8-16(22)19(10-14,18(24)25)9-13-5-3-2-4-6-13;2-1-3/h2-6,11-12,14,16H,7-10H2,1H3,(H,24,25);1H,(H,2,3)/t14-,16+,19+;/m0./s1 |
| InChIKey | BAZNKBDDWMVYSN-ABFSMSCSSA-N |
| XLogP | 1.81 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|