C21H29N5O3 — CID 154923717
2-[4-[2-[4-[1-(dimethylamino)ethyl]phenyl]imidazol-1-yl]-3,5-dimethylpyrazol-1-yl]ethanol;formic acid (PubChem CID 154923717) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-[4-[2-[4-[1-(dimethylamino)ethyl]phenyl]imidazol-1-yl]-3,5-dimethylpyrazol-1-yl]ethanol;formic acid.
| Compound Name | 2-[4-[2-[4-[1-(dimethylamino)ethyl]phenyl]imidazol-1-yl]-3,5-dimethylpyrazol-1-yl]ethanol;formic acid |
|---|---|
| PubChem CID | 154923717 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-[4-[2-[4-[1-(dimethylamino)ethyl]phenyl]imidazol-1-yl]-3,5-dimethylpyrazol-1-yl]ethanol;formic acid |
| SMILES | Cc1nn(CCO)c(C)c1-n1ccnc1-c1ccc(C(C)N(C)C)cc1.O=CO |
| InChI | InChI=1S/C20H27N5O.CH2O2/c1-14-19(16(3)25(22-14)12-13-26)24-11-10-21-20(24)18-8-6-17(7-9-18)15(2)23(4)5;2-1-3/h6-11,15,26H,12-13H2,1-5H3;1H,(H,2,3) |
| InChIKey | YTOGUKCAXISPOB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|