C23H36N4O5 — CID 154923917
acetic acid;1,3-dimethyl-8-[(1R,2R,4S)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 154923917) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is acetic acid;1,3-dimethyl-8-[(1R,2R,4S)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | acetic acid;1,3-dimethyl-8-[(1R,2R,4S)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 154923917 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | acetic acid;1,3-dimethyl-8-[(1R,2R,4S)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(=O)O.CC(C)=CC[C@@]1(C(=O)N2CCC3(CC2)C(=O)N(C)C(=O)N3C)C[C@@H]2CC[C@H]1N2 |
| InChI | InChI=1S/C21H32N4O3.C2H4O2/c1-14(2)7-8-20(13-15-5-6-16(20)22-15)17(26)25-11-9-21(10-12-25)18(27)23(3)19(28)24(21)4;1-2(3)4/h7,15-16,22H,5-6,8-13H2,1-4H3;1H3,(H,3,4)/t15-,16+,20+;/m0./s1 |
| InChIKey | FQKLWOWCIQBTFO-QCVLXNBVSA-N |
| XLogP | 1.83 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|