About 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride
6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride (PubChem CID 154924547) has the molecular formula C17H31Cl2N5O
and a molecular weight of 392.38 g/mol. Its IUPAC name is 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride |
| PubChem CID | 154924547 |
| Molecular Formula | C17H31Cl2N5O |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride |
| SMILES | CCc1cc(NCC2CNCCOC2)nc(N2CCCCC2)n1.Cl.Cl |
| InChI | InChI=1S/C17H29N5O.2ClH/c1-2-15-10-16(19-12-14-11-18-6-9-23-13-14)21-17(20-15)22-7-4-3-5-8-22;;/h10,14,18H,2-9,11-13H2,1H3,(H,19,20,21);2*1H |
| InChIKey | UQRGCLPSCNLOOQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride?
The IUPAC name of 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride (CID 154924547) is 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride.
What is the SMILES notation for 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride?
The canonical SMILES for 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride is CCc1cc(NCC2CNCCOC2)nc(N2CCCCC2)n1.Cl.Cl.
What is the InChIKey of 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride?
The InChIKey is UQRGCLPSCNLOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N5O.2ClH/c1-2-15-10-16(19-12-14-11-18-6-9-23-13-14)21-17(20-15)22-7-4-3-5-8-22;;/h10,14,18H,2-9,11-13H2,1H3,(H,19,20,21);2*1H.
What are the key properties of 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride?
6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride has a molecular weight of 392.38 g/mol, XLogP of 2.52, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N-(1,4-oxazepan-6-ylmethyl)-2-piperidin-1-ylpyrimidin-4-amine;dihydrochloride is sourced from PubChem (CID 154924547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).